C10H8N4O3 — CID 168650875
2-formamido-4-(1,2,4-triazol-4-yl)benzoic acid (PubChem CID 168650875) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-formamido-4-(1,2,4-triazol-4-yl)benzoic acid.
| Compound Name | 2-formamido-4-(1,2,4-triazol-4-yl)benzoic acid |
|---|---|
| PubChem CID | 168650875 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 2-formamido-4-(1,2,4-triazol-4-yl)benzoic acid |
| SMILES | O=CNc1cc(-n2cnnc2)ccc1C(=O)O |
| InChI | InChI=1S/C10H8N4O3/c15-6-11-9-3-7(14-4-12-13-5-14)1-2-8(9)10(16)17/h1-6H,(H,11,15)(H,16,17) |
| InChIKey | AAJQWGOZPXFAOA-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|