C13H13ClF3N3O2 — CID 168653562
N-[5-chloro-2-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]formamide (PubChem CID 168653562) has the molecular formula C13H13ClF3N3O2 and a molecular weight of 335.71 g/mol. Its IUPAC name is N-[5-chloro-2-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]formamide.
| Compound Name | N-[5-chloro-2-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]formamide |
|---|---|
| PubChem CID | 168653562 |
| Molecular Formula | C13H13ClF3N3O2 |
| Molecular Weight | 335.71 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-[5-chloro-2-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]phenyl]formamide |
| SMILES | O=CNc1cc(Cl)ccc1N1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H13ClF3N3O2/c14-9-1-2-11(10(7-9)18-8-21)19-3-5-20(6-4-19)12(22)13(15,16)17/h1-2,7-8H,3-6H2,(H,18,21) |
| InChIKey | GQOKGHLIPVISSD-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|