C10H11Cl2N3O2 — CID 168663479
1-(3-amino-2,6-dichloro-4-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168663479) has the molecular formula C10H11Cl2N3O2 and a molecular weight of 276.12 g/mol. Its IUPAC name is 1-(3-amino-2,6-dichloro-4-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(3-amino-2,6-dichloro-4-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168663479 |
| Molecular Formula | C10H11Cl2N3O2 |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 275.02 |
| IUPAC Name | 1-(3-amino-2,6-dichloro-4-pyridinyl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | Nc1c(N2CC(CO)CC2=O)cc(Cl)nc1Cl |
| InChI | InChI=1S/C10H11Cl2N3O2/c11-7-2-6(9(13)10(12)14-7)15-3-5(4-16)1-8(15)17/h2,5,16H,1,3-4,13H2 |
| InChIKey | JGVYLXWCZQVONY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|