C11H16BrClN4O — CID 168665014
1-(2-bromo-6-methylphenyl)-3-[(ethylhydrazinylidene)methyl]urea;hydrochloride (PubChem CID 168665014) has the molecular formula C11H16BrClN4O and a molecular weight of 335.63 g/mol. Its IUPAC name is 1-(2-bromo-6-methylphenyl)-3-[(ethylhydrazinylidene)methyl]urea;hydrochloride.
| Compound Name | 1-(2-bromo-6-methylphenyl)-3-[(ethylhydrazinylidene)methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 168665014 |
| Molecular Formula | C11H16BrClN4O |
| Molecular Weight | 335.63 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | 1-(2-bromo-6-methylphenyl)-3-[(ethylhydrazinylidene)methyl]urea;hydrochloride |
| SMILES | CCNN=CNC(=O)Nc1c(C)cccc1Br.Cl |
| InChI | InChI=1S/C11H15BrN4O.ClH/c1-3-14-15-7-13-11(17)16-10-8(2)5-4-6-9(10)12;/h4-7,14H,3H2,1-2H3,(H2,13,15,16,17);1H |
| InChIKey | WGWSNRJQDHLLGR-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.63 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|