C13H21ClN4O — CID 168664869
1-(2,6-dimethylphenyl)-3-[[ethyl(methyl)hydrazinylidene]methyl]urea;hydrochloride (PubChem CID 168664869) has the molecular formula C13H21ClN4O and a molecular weight of 284.79 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[[ethyl(methyl)hydrazinylidene]methyl]urea;hydrochloride.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[[ethyl(methyl)hydrazinylidene]methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 168664869 |
| Molecular Formula | C13H21ClN4O |
| Molecular Weight | 284.79 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[[ethyl(methyl)hydrazinylidene]methyl]urea;hydrochloride |
| SMILES | CCN(C)N=CNC(=O)Nc1c(C)cccc1C.Cl |
| InChI | InChI=1S/C13H20N4O.ClH/c1-5-17(4)15-9-14-13(18)16-12-10(2)7-6-8-11(12)3;/h6-9H,5H2,1-4H3,(H2,14,15,16,18);1H |
| InChIKey | LEKVXWVZNVRZKN-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.79 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|