C16H27ClN4O — CID 135599694
1-(2,6-dimethylphenyl)-3-[(E)-(hexylhydrazinylidene)methyl]urea;hydrochloride (PubChem CID 135599694) has the molecular formula C16H27ClN4O and a molecular weight of 326.87 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-[(E)-(hexylhydrazinylidene)methyl]urea;hydrochloride.
| Compound Name | 1-(2,6-dimethylphenyl)-3-[(E)-(hexylhydrazinylidene)methyl]urea;hydrochloride |
|---|---|
| PubChem CID | 135599694 |
| Molecular Formula | C16H27ClN4O |
| Molecular Weight | 326.87 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-[(E)-(hexylhydrazinylidene)methyl]urea;hydrochloride |
| SMILES | CCCCCCN/N=C/NC(=O)Nc1c(C)cccc1C.Cl |
| InChI | InChI=1S/C16H26N4O.ClH/c1-4-5-6-7-11-18-19-12-17-16(21)20-15-13(2)9-8-10-14(15)3;/h8-10,12,18H,4-7,11H2,1-3H3,(H2,17,19,20,21);1H |
| InChIKey | SUROTNBOVHTUFM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.87 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|