C12H17ClN4O — CID 135599697
1-[(E)-(2-chloroethylhydrazinylidene)methyl]-3-(2,6-dimethylphenyl)urea (PubChem CID 135599697) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 1-[(E)-(2-chloroethylhydrazinylidene)methyl]-3-(2,6-dimethylphenyl)urea.
| Compound Name | 1-[(E)-(2-chloroethylhydrazinylidene)methyl]-3-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 135599697 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 1-[(E)-(2-chloroethylhydrazinylidene)methyl]-3-(2,6-dimethylphenyl)urea |
| SMILES | Cc1cccc(C)c1NC(=O)N/C=N/NCCCl |
| InChI | InChI=1S/C12H17ClN4O/c1-9-4-3-5-10(2)11(9)17-12(18)14-8-16-15-7-6-13/h3-5,8,15H,6-7H2,1-2H3,(H2,14,16,17,18) |
| InChIKey | SSPXFEOQODWHPC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|