C13H25ClN2O3S — CID 168672770
[1-[2-(dipropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672770) has the molecular formula C13H25ClN2O3S and a molecular weight of 324.87 g/mol. Its IUPAC name is [1-[2-(dipropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[2-(dipropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672770 |
| Molecular Formula | C13H25ClN2O3S |
| Molecular Weight | 324.87 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [1-[2-(dipropylamino)ethyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CCCN(CCC)CCN1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C13H25ClN2O3S/c1-3-5-15(6-4-2)7-8-16-10-12(9-13(16)17)11-20(14,18)19/h12H,3-11H2,1-2H3 |
| InChIKey | JWONVWINTWKEOY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.87 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |