C16H23ClN2O3S — CID 168672929
[1-[4-(N-methylanilino)butyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672929) has the molecular formula C16H23ClN2O3S and a molecular weight of 358.89 g/mol. Its IUPAC name is [1-[4-(N-methylanilino)butyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-[4-(N-methylanilino)butyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672929 |
| Molecular Formula | C16H23ClN2O3S |
| Molecular Weight | 358.89 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | [1-[4-(N-methylanilino)butyl]-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CN(CCCCN1CC(CS(=O)(=O)Cl)CC1=O)c1ccccc1 |
| InChI | InChI=1S/C16H23ClN2O3S/c1-18(15-7-3-2-4-8-15)9-5-6-10-19-12-14(11-16(19)20)13-23(17,21)22/h2-4,7-8,14H,5-6,9-13H2,1H3 |
| InChIKey | QTAVGYLUQVDWJD-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.89 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|