C29H36F3N9O3S — CID 168679414
N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 168679414) has the molecular formula C29H36F3N9O3S and a molecular weight of 647.73 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 168679414 |
| Molecular Formula | C29H36F3N9O3S |
| Molecular Weight | 647.73 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfanyl-4-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CSc1cc(C(F)(F)F)c(C(=O)Nc2cc(-n3cc(C(=O)NCCCN4CCOCC4)nn3)ccc2N2CCN(C)CC2)cn1 |
| InChI | InChI=1S/C29H36F3N9O3S/c1-38-8-10-40(11-9-38)25-5-4-20(16-23(25)35-27(42)21-18-34-26(45-2)17-22(21)29(30,31)32)41-19-24(36-37-41)28(43)33-6-3-7-39-12-14-44-15-13-39/h4-5,16-19H,3,6-15H2,1-2H3,(H,33,43)(H,35,42) |
| InChIKey | DSUXBAGJQWXSAY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.73 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|