C28H35F3N10O3 — CID 169188957
N-[2-(3-amino-4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 169188957) has the molecular formula C28H35F3N10O3 and a molecular weight of 616.65 g/mol. Its IUPAC name is N-[2-(3-amino-4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[2-(3-amino-4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 169188957 |
| Molecular Formula | C28H35F3N10O3 |
| Molecular Weight | 616.65 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | N-[2-(3-amino-4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(-n3cc(C(=O)NCCCN4CCOCC4)nn3)cc2NC(=O)c2cccnc2C(F)(F)F)CC1N |
| InChI | InChI=1S/C28H35F3N10O3/c1-38-10-11-40(18-24(38)32)23-6-5-19(16-21(23)35-26(42)20-4-2-7-33-25(20)28(29,30)31)41-17-22(36-37-41)27(43)34-8-3-9-39-12-14-44-15-13-39/h2,4-7,16-17,24H,3,8-15,18,32H2,1H3,(H,34,43)(H,35,42) |
| InChIKey | TUZIPIJMWBHJMG-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.65 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|