C33H43ClF2N10O3 — CID 169052371
5-amino-6-chloro-N-[2-(4-cyclohexylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(difluoromethyl)pyridine-3-carboxamide (PubChem CID 169052371) has the molecular formula C33H43ClF2N10O3 and a molecular weight of 701.22 g/mol. Its IUPAC name is 5-amino-6-chloro-N-[2-(4-cyclohexylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(difluoromethyl)pyridine-3-carboxamide.
| Compound Name | 5-amino-6-chloro-N-[2-(4-cyclohexylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(difluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 169052371 |
| Molecular Formula | C33H43ClF2N10O3 |
| Molecular Weight | 701.22 g/mol |
| Exact Mass | 700.32 |
| IUPAC Name | 5-amino-6-chloro-N-[2-(4-cyclohexylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-2-(difluoromethyl)pyridine-3-carboxamide |
| SMILES | Nc1cc(C(=O)Nc2cc(-n3cc(C(=O)NCCCN4CCOCC4)nn3)ccc2N2CCN(C3CCCCC3)CC2)c(C(F)F)nc1Cl |
| InChI | InChI=1S/C33H43ClF2N10O3/c34-30-25(37)20-24(29(40-30)31(35)36)32(47)39-26-19-23(7-8-28(26)45-13-11-44(12-14-45)22-5-2-1-3-6-22)46-21-27(41-42-46)33(48)38-9-4-10-43-15-17-49-18-16-43/h7-8,19-22,31H,1-6,9-18,37H2,(H,38,48)(H,39,47) |
| InChIKey | SBBNERRYNMUOCX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|