C27H35ClN10O5S — CID 169052378
4-chloro-N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfonylpyridazine-3-carboxamide (PubChem CID 169052378) has the molecular formula C27H35ClN10O5S and a molecular weight of 647.16 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfonylpyridazine-3-carboxamide.
| Compound Name | 4-chloro-N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfonylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 169052378 |
| Molecular Formula | C27H35ClN10O5S |
| Molecular Weight | 647.16 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 4-chloro-N-[2-(4-methylpiperazin-1-yl)-5-[4-(3-morpholin-4-ylpropylcarbamoyl)triazol-1-yl]phenyl]-6-methylsulfonylpyridazine-3-carboxamide |
| SMILES | CN1CCN(c2ccc(-n3cc(C(=O)NCCCN4CCOCC4)nn3)cc2NC(=O)c2nnc(S(C)(=O)=O)cc2Cl)CC1 |
| InChI | InChI=1S/C27H35ClN10O5S/c1-35-8-10-37(11-9-35)23-5-4-19(16-21(23)30-27(40)25-20(28)17-24(32-33-25)44(2,41)42)38-18-22(31-34-38)26(39)29-6-3-7-36-12-14-43-15-13-36/h4-5,16-18H,3,6-15H2,1-2H3,(H,29,39)(H,30,40) |
| InChIKey | WJAPHFPERYFMID-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 167.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.16 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|