C30H39ClFN9O3 — CID 169052086
1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(3,4-dimethylpiperazin-1-yl)phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide (PubChem CID 169052086) has the molecular formula C30H39ClFN9O3 and a molecular weight of 628.15 g/mol. Its IUPAC name is 1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(3,4-dimethylpiperazin-1-yl)phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide.
| Compound Name | 1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(3,4-dimethylpiperazin-1-yl)phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 169052086 |
| Molecular Formula | C30H39ClFN9O3 |
| Molecular Weight | 628.15 g/mol |
| Exact Mass | 627.28 |
| IUPAC Name | 1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(3,4-dimethylpiperazin-1-yl)phenyl]-N-(3-morpholin-4-ylpropyl)triazole-4-carboxamide |
| SMILES | Cc1c(F)c(N)cc(C(=O)Nc2cc(-n3cc(C(=O)NCCCN4CCOCC4)nn3)ccc2N2CCN(C)C(C)C2)c1Cl |
| InChI | InChI=1S/C30H39ClFN9O3/c1-19-17-40(10-9-38(19)3)26-6-5-21(15-24(26)35-29(42)22-16-23(33)28(32)20(2)27(22)31)41-18-25(36-37-41)30(43)34-7-4-8-39-11-13-44-14-12-39/h5-6,15-16,18-19H,4,7-14,17,33H2,1-3H3,(H,34,43)(H,35,42) |
| InChIKey | JBTAIVIQFXLQAZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.15 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|