C26H31ClFN7O3 — CID 168679362
2-methylpropyl 1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate (PubChem CID 168679362) has the molecular formula C26H31ClFN7O3 and a molecular weight of 544.03 g/mol. Its IUPAC name is 2-methylpropyl 1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate.
| Compound Name | 2-methylpropyl 1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 168679362 |
| Molecular Formula | C26H31ClFN7O3 |
| Molecular Weight | 544.03 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 2-methylpropyl 1-[3-[(5-amino-2-chloro-4-fluoro-3-methylbenzoyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate |
| SMILES | Cc1c(F)c(N)cc(C(=O)Nc2cc(-n3cc(C(=O)OCC(C)C)nn3)ccc2N2CCN(C)CC2)c1Cl |
| InChI | InChI=1S/C26H31ClFN7O3/c1-15(2)14-38-26(37)21-13-35(32-31-21)17-5-6-22(34-9-7-33(4)8-10-34)20(11-17)30-25(36)18-12-19(29)24(28)16(3)23(18)27/h5-6,11-13,15H,7-10,14,29H2,1-4H3,(H,30,36) |
| InChIKey | KNEDNWWENFKPAP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.03 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|