C31H40FN7O3 — CID 169052357
(1-methylcyclohexyl)methyl 1-[3-[(6-fluoro-4-propan-2-ylpyridine-3-carbonyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate (PubChem CID 169052357) has the molecular formula C31H40FN7O3 and a molecular weight of 577.71 g/mol. Its IUPAC name is (1-methylcyclohexyl)methyl 1-[3-[(6-fluoro-4-propan-2-ylpyridine-3-carbonyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate.
| Compound Name | (1-methylcyclohexyl)methyl 1-[3-[(6-fluoro-4-propan-2-ylpyridine-3-carbonyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 169052357 |
| Molecular Formula | C31H40FN7O3 |
| Molecular Weight | 577.71 g/mol |
| Exact Mass | 577.32 |
| IUPAC Name | (1-methylcyclohexyl)methyl 1-[3-[(6-fluoro-4-propan-2-ylpyridine-3-carbonyl)amino]-4-(4-methylpiperazin-1-yl)phenyl]triazole-4-carboxylate |
| SMILES | CC(C)c1cc(F)ncc1C(=O)Nc1cc(-n2cc(C(=O)OCC3(C)CCCCC3)nn2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C31H40FN7O3/c1-21(2)23-17-28(32)33-18-24(23)29(40)34-25-16-22(8-9-27(25)38-14-12-37(4)13-15-38)39-19-26(35-36-39)30(41)42-20-31(3)10-6-5-7-11-31/h8-9,16-19,21H,5-7,10-15,20H2,1-4H3,(H,34,40) |
| InChIKey | DABDUZZIVNEQAD-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|