C22H21ClF3N7O3 — CID 169052513
1-[3-[[6-chloro-4-(trifluoromethyl)pyridine-3-carbonyl]amino]-4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]triazole-4-carboxylic acid (PubChem CID 169052513) has the molecular formula C22H21ClF3N7O3 and a molecular weight of 523.90 g/mol. Its IUPAC name is 1-[3-[[6-chloro-4-(trifluoromethyl)pyridine-3-carbonyl]amino]-4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]triazole-4-carboxylic acid.
| Compound Name | 1-[3-[[6-chloro-4-(trifluoromethyl)pyridine-3-carbonyl]amino]-4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 169052513 |
| Molecular Formula | C22H21ClF3N7O3 |
| Molecular Weight | 523.90 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 1-[3-[[6-chloro-4-(trifluoromethyl)pyridine-3-carbonyl]amino]-4-[(3S)-3,4-dimethylpiperazin-1-yl]phenyl]triazole-4-carboxylic acid |
| SMILES | C[C@H]1CN(c2ccc(-n3cc(C(=O)O)nn3)cc2NC(=O)c2cnc(Cl)cc2C(F)(F)F)CCN1C |
| InChI | InChI=1S/C22H21ClF3N7O3/c1-12-10-32(6-5-31(12)2)18-4-3-13(33-11-17(21(35)36)29-30-33)7-16(18)28-20(34)14-9-27-19(23)8-15(14)22(24,25)26/h3-4,7-9,11-12H,5-6,10H2,1-2H3,(H,28,34)(H,35,36)/t12-/m0/s1 |
| InChIKey | ADXRGMLDMIGPET-LBPRGKRZSA-N |
| XLogP | 3.43 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.90 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|