C28H38N10O3 — CID 169188965
N-[5-[4-[(1-amino-3-morpholin-4-ylpropyl)carbamoyl]triazol-1-yl]-2-(4-methylpiperazin-1-yl)phenyl]-4-methylpyridine-3-carboxamide (PubChem CID 169188965) has the molecular formula C28H38N10O3 and a molecular weight of 562.68 g/mol. Its IUPAC name is N-[5-[4-[(1-amino-3-morpholin-4-ylpropyl)carbamoyl]triazol-1-yl]-2-(4-methylpiperazin-1-yl)phenyl]-4-methylpyridine-3-carboxamide.
| Compound Name | N-[5-[4-[(1-amino-3-morpholin-4-ylpropyl)carbamoyl]triazol-1-yl]-2-(4-methylpiperazin-1-yl)phenyl]-4-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 169188965 |
| Molecular Formula | C28H38N10O3 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.31 |
| IUPAC Name | N-[5-[4-[(1-amino-3-morpholin-4-ylpropyl)carbamoyl]triazol-1-yl]-2-(4-methylpiperazin-1-yl)phenyl]-4-methylpyridine-3-carboxamide |
| SMILES | Cc1ccncc1C(=O)Nc1cc(-n2cc(C(=O)NC(N)CCN3CCOCC3)nn2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C28H38N10O3/c1-20-5-7-30-18-22(20)27(39)31-23-17-21(3-4-25(23)37-11-9-35(2)10-12-37)38-19-24(33-34-38)28(40)32-26(29)6-8-36-13-15-41-16-14-36/h3-5,7,17-19,26H,6,8-16,29H2,1-2H3,(H,31,39)(H,32,40) |
| InChIKey | ONKRQINGXZSVRA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 146.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|