C18H12N2S — CID 168679919
4,7-diphenyl-1,2,3-benzothiadiazole (PubChem CID 168679919) has the molecular formula C18H12N2S and a molecular weight of 288.38 g/mol. Its IUPAC name is 4,7-diphenyl-1,2,3-benzothiadiazole.
| Compound Name | 4,7-diphenyl-1,2,3-benzothiadiazole |
|---|---|
| PubChem CID | 168679919 |
| Molecular Formula | C18H12N2S |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 4,7-diphenyl-1,2,3-benzothiadiazole |
| SMILES | c1ccc(-c2ccc(-c3ccccc3)c3snnc23)cc1 |
| InChI | InChI=1S/C18H12N2S/c1-3-7-13(8-4-1)15-11-12-16(14-9-5-2-6-10-14)18-17(15)19-20-21-18/h1-12H |
| InChIKey | NGSXPMXHEBYKQB-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |