C14H26N2O3S — CID 168680639
[5-oxo-1-(4-propan-2-ylcyclohexyl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168680639) has the molecular formula C14H26N2O3S and a molecular weight of 302.44 g/mol. Its IUPAC name is [5-oxo-1-(4-propan-2-ylcyclohexyl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-(4-propan-2-ylcyclohexyl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168680639 |
| Molecular Formula | C14H26N2O3S |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | [5-oxo-1-(4-propan-2-ylcyclohexyl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | CC(C)C1CCC(N2CC(CS(N)(=O)=O)CC2=O)CC1 |
| InChI | InChI=1S/C14H26N2O3S/c1-10(2)12-3-5-13(6-4-12)16-8-11(7-14(16)17)9-20(15,18)19/h10-13H,3-9H2,1-2H3,(H2,15,18,19) |
| InChIKey | QSQVGIFVSVHFSP-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |