C14H21N5O3S — CID 168681810
[5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681810) has the molecular formula C14H21N5O3S and a molecular weight of 339.42 g/mol. Its IUPAC name is [5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681810 |
| Molecular Formula | C14H21N5O3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | [5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(C2CCN(c3ncccn3)CC2)C1 |
| InChI | InChI=1S/C14H21N5O3S/c15-23(21,22)10-11-8-13(20)19(9-11)12-2-6-18(7-3-12)14-16-4-1-5-17-14/h1,4-5,11-12H,2-3,6-10H2,(H2,15,21,22) |
| InChIKey | MVCRIBSLZBKFAU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |