C13H17ClN4O3S — CID 168712009
5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidine-3-sulfonyl chloride (PubChem CID 168712009) has the molecular formula C13H17ClN4O3S and a molecular weight of 344.82 g/mol. Its IUPAC name is 5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidine-3-sulfonyl chloride.
| Compound Name | 5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712009 |
| Molecular Formula | C13H17ClN4O3S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 5-oxo-1-(1-pyrimidin-2-ylpiperidin-4-yl)pyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1C1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C13H17ClN4O3S/c14-22(20,21)11-8-12(19)18(9-11)10-2-6-17(7-3-10)13-15-4-1-5-16-13/h1,4-5,10-11H,2-3,6-9H2 |
| InChIKey | SITQJOUFHQZSRG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |