C9H8F3N3O2 — CID 168686730
4-ethenyl-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-2-one (PubChem CID 168686730) has the molecular formula C9H8F3N3O2 and a molecular weight of 247.18 g/mol. Its IUPAC name is 4-ethenyl-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168686730 |
| Molecular Formula | C9H8F3N3O2 |
| Molecular Weight | 247.18 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 4-ethenyl-1-[5-(trifluoromethyl)-1,3,4-oxadiazol-2-yl]pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2nnc(C(F)(F)F)o2)C1 |
| InChI | InChI=1S/C9H8F3N3O2/c1-2-5-3-6(16)15(4-5)8-14-13-7(17-8)9(10,11)12/h2,5H,1,3-4H2 |
| InChIKey | VACPBUYHGDATIS-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|