C12H11ClN2O2 — CID 168689136
5-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-dihydroindol-2-one (PubChem CID 168689136) has the molecular formula C12H11ClN2O2 and a molecular weight of 250.68 g/mol. Its IUPAC name is 5-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-dihydroindol-2-one.
| Compound Name | 5-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 168689136 |
| Molecular Formula | C12H11ClN2O2 |
| Molecular Weight | 250.68 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 5-(4-chloro-2-oxopyrrolidin-1-yl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(N3CC(Cl)CC3=O)ccc2N1 |
| InChI | InChI=1S/C12H11ClN2O2/c13-8-5-12(17)15(6-8)9-1-2-10-7(3-9)4-11(16)14-10/h1-3,8H,4-6H2,(H,14,16) |
| InChIKey | NVZQRRZMHVJIOB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.68 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|