C8H8ClN3O3 — CID 168689959
6-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrimidine-2,4-dione (PubChem CID 168689959) has the molecular formula C8H8ClN3O3 and a molecular weight of 229.62 g/mol. Its IUPAC name is 6-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 168689959 |
| Molecular Formula | C8H8ClN3O3 |
| Molecular Weight | 229.62 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 6-(4-chloro-2-oxopyrrolidin-1-yl)-1H-pyrimidine-2,4-dione |
| SMILES | O=C1CC(Cl)CN1c1cc(=O)[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C8H8ClN3O3/c9-4-1-7(14)12(3-4)5-2-6(13)11-8(15)10-5/h2,4H,1,3H2,(H2,10,11,13,15) |
| InChIKey | SHWPPBOIBCXRJF-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.62 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|