C13H15NO5S — CID 168693950
methyl 1-(3-methoxycarbonyl-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168693950) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is methyl 1-(3-methoxycarbonyl-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(3-methoxycarbonyl-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168693950 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | methyl 1-(3-methoxycarbonyl-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)c1c(C)csc1N1CC(C(=O)OC)CC1=O |
| InChI | InChI=1S/C13H15NO5S/c1-7-6-20-11(10(7)13(17)19-3)14-5-8(4-9(14)15)12(16)18-2/h6,8H,4-5H2,1-3H3 |
| InChIKey | HNLUBECPTOWQIT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |