C12H12BrNO5S — CID 168693346
methyl 1-(4-bromo-2-methoxycarbonylthiophen-3-yl)-5-oxopyrrolidine-3-carboxylate (PubChem CID 168693346) has the molecular formula C12H12BrNO5S and a molecular weight of 362.20 g/mol. Its IUPAC name is methyl 1-(4-bromo-2-methoxycarbonylthiophen-3-yl)-5-oxopyrrolidine-3-carboxylate.
| Compound Name | methyl 1-(4-bromo-2-methoxycarbonylthiophen-3-yl)-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168693346 |
| Molecular Formula | C12H12BrNO5S |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | methyl 1-(4-bromo-2-methoxycarbonylthiophen-3-yl)-5-oxopyrrolidine-3-carboxylate |
| SMILES | COC(=O)c1scc(Br)c1N1CC(C(=O)OC)CC1=O |
| InChI | InChI=1S/C12H12BrNO5S/c1-18-11(16)6-3-8(15)14(4-6)9-7(13)5-20-10(9)12(17)19-2/h5-6H,3-4H2,1-2H3 |
| InChIKey | BDUJWRDCZFNLOJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |