C11H14N2O5S2 — CID 168717961
methyl 4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)thiophene-3-carboxylate (PubChem CID 168717961) has the molecular formula C11H14N2O5S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is methyl 4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)thiophene-3-carboxylate.
| Compound Name | methyl 4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 168717961 |
| Molecular Formula | C11H14N2O5S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | methyl 4-methyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(C)csc1N1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C11H14N2O5S2/c1-6-5-19-10(9(6)11(15)18-2)13-4-7(3-8(13)14)20(12,16)17/h5,7H,3-4H2,1-2H3,(H2,12,16,17) |
| InChIKey | YDVKYBLYDSYYEK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |