C10H9ClN2O3S2 — CID 168711935
1-(3-cyano-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711935) has the molecular formula C10H9ClN2O3S2 and a molecular weight of 304.78 g/mol. Its IUPAC name is 1-(3-cyano-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(3-cyano-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711935 |
| Molecular Formula | C10H9ClN2O3S2 |
| Molecular Weight | 304.78 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 1-(3-cyano-4-methylthiophen-2-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | Cc1csc(N2CC(S(=O)(=O)Cl)CC2=O)c1C#N |
| InChI | InChI=1S/C10H9ClN2O3S2/c1-6-5-17-10(8(6)3-12)13-4-7(2-9(13)14)18(11,15)16/h5,7H,2,4H2,1H3 |
| InChIKey | JPULWVXNWPMGEA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.78 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |