C12H10N4O3 — CID 168694037
methyl 5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidine-3-carboxylate (PubChem CID 168694037) has the molecular formula C12H10N4O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is methyl 5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168694037 |
| Molecular Formula | C12H10N4O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | methyl 5-oxo-1-(1,1,3-tricyanoprop-1-en-2-yl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(C(CC#N)=C(C#N)C#N)C1 |
| InChI | InChI=1S/C12H10N4O3/c1-19-12(18)8-4-11(17)16(7-8)10(2-3-13)9(5-14)6-15/h8H,2,4,7H2,1H3 |
| InChIKey | SUICLBWCMQZUPG-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 117.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|