C10H8N4O2 — CID 168702821
2-(4-hydroxy-2-oxopyrrolidin-1-yl)prop-1-ene-1,1,3-tricarbonitrile (PubChem CID 168702821) has the molecular formula C10H8N4O2 and a molecular weight of 216.20 g/mol. Its IUPAC name is 2-(4-hydroxy-2-oxopyrrolidin-1-yl)prop-1-ene-1,1,3-tricarbonitrile.
| Compound Name | 2-(4-hydroxy-2-oxopyrrolidin-1-yl)prop-1-ene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 168702821 |
| Molecular Formula | C10H8N4O2 |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 2-(4-hydroxy-2-oxopyrrolidin-1-yl)prop-1-ene-1,1,3-tricarbonitrile |
| SMILES | N#CCC(=C(C#N)C#N)N1CC(O)CC1=O |
| InChI | InChI=1S/C10H8N4O2/c11-2-1-9(7(4-12)5-13)14-6-8(15)3-10(14)16/h8,15H,1,3,6H2 |
| InChIKey | QUYKKNMPEYKZIY-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|