C13H14N6O — CID 168701244
4-amino-1-(4-amino-6-phenyl-1,3,5-triazin-2-yl)pyrrolidin-2-one (PubChem CID 168701244) has the molecular formula C13H14N6O and a molecular weight of 270.30 g/mol. Its IUPAC name is 4-amino-1-(4-amino-6-phenyl-1,3,5-triazin-2-yl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-(4-amino-6-phenyl-1,3,5-triazin-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168701244 |
| Molecular Formula | C13H14N6O |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 4-amino-1-(4-amino-6-phenyl-1,3,5-triazin-2-yl)pyrrolidin-2-one |
| SMILES | Nc1nc(-c2ccccc2)nc(N2CC(N)CC2=O)n1 |
| InChI | InChI=1S/C13H14N6O/c14-9-6-10(20)19(7-9)13-17-11(16-12(15)18-13)8-4-2-1-3-5-8/h1-5,9H,6-7,14H2,(H2,15,16,17,18) |
| InChIKey | ZHSLRSONHWVSAV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |