C11H10N2O2S — CID 168703402
1-(1,3-benzothiazol-5-yl)-4-hydroxypyrrolidin-2-one (PubChem CID 168703402) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-5-yl)-4-hydroxypyrrolidin-2-one.
| Compound Name | 1-(1,3-benzothiazol-5-yl)-4-hydroxypyrrolidin-2-one |
|---|---|
| PubChem CID | 168703402 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 1-(1,3-benzothiazol-5-yl)-4-hydroxypyrrolidin-2-one |
| SMILES | O=C1CC(O)CN1c1ccc2scnc2c1 |
| InChI | InChI=1S/C11H10N2O2S/c14-8-4-11(15)13(5-8)7-1-2-10-9(3-7)12-6-16-10/h1-3,6,8,14H,4-5H2 |
| InChIKey | AULKDNFGPNFKOE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |