C13H14BrNO4S2 — CID 168705367
S-[1-(2-bromo-4-methylsulfonylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705367) has the molecular formula C13H14BrNO4S2 and a molecular weight of 392.30 g/mol. Its IUPAC name is S-[1-(2-bromo-4-methylsulfonylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2-bromo-4-methylsulfonylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705367 |
| Molecular Formula | C13H14BrNO4S2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 390.95 |
| IUPAC Name | S-[1-(2-bromo-4-methylsulfonylphenyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ccc(S(C)(=O)=O)cc2Br)C1 |
| InChI | InChI=1S/C13H14BrNO4S2/c1-8(16)20-9-5-13(17)15(7-9)12-4-3-10(6-11(12)14)21(2,18)19/h3-4,6,9H,5,7H2,1-2H3 |
| InChIKey | WPWLUQQKUYTQKT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|