C14H22N2O3S — CID 168707507
tert-butyl (1S,5R)-6-(2-oxo-4-sulfanylpyrrolidin-1-yl)-3-azabicyclo[3.1.0]hexane-3-carboxylate (PubChem CID 168707507) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is tert-butyl (1S,5R)-6-(2-oxo-4-sulfanylpyrrolidin-1-yl)-3-azabicyclo[3.1.0]hexane-3-carboxylate.
| Compound Name | tert-butyl (1S,5R)-6-(2-oxo-4-sulfanylpyrrolidin-1-yl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
|---|---|
| PubChem CID | 168707507 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | tert-butyl (1S,5R)-6-(2-oxo-4-sulfanylpyrrolidin-1-yl)-3-azabicyclo[3.1.0]hexane-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2C(N3CC(S)CC3=O)[C@@H]2C1 |
| InChI | InChI=1S/C14H22N2O3S/c1-14(2,3)19-13(18)15-6-9-10(7-15)12(9)16-5-8(20)4-11(16)17/h8-10,12,20H,4-7H2,1-3H3/t8?,9-,10+,12? |
| InChIKey | JTIVNWUXBYQYNS-PYDJHFLYSA-N |
| XLogP | 1.38 |
| TPSA | 49.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|