C15H21ClN2O3S — CID 168711199
1-[2-(N-ethyl-3-methylanilino)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711199) has the molecular formula C15H21ClN2O3S and a molecular weight of 344.86 g/mol. Its IUPAC name is 1-[2-(N-ethyl-3-methylanilino)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711199 |
| Molecular Formula | C15H21ClN2O3S |
| Molecular Weight | 344.86 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[2-(N-ethyl-3-methylanilino)ethyl]-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | CCN(CCN1CC(S(=O)(=O)Cl)CC1=O)c1cccc(C)c1 |
| InChI | InChI=1S/C15H21ClN2O3S/c1-3-17(13-6-4-5-12(2)9-13)7-8-18-11-14(10-15(18)19)22(16,20)21/h4-6,9,14H,3,7-8,10-11H2,1-2H3 |
| InChIKey | HJFKAXPMZRANOY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.86 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |