C13H21FN2O6S — CID 168713024
tert-butyl 3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-hydroxypyrrolidine-1-carboxylate (PubChem CID 168713024) has the molecular formula C13H21FN2O6S and a molecular weight of 352.38 g/mol. Its IUPAC name is tert-butyl 3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-hydroxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-hydroxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 168713024 |
| Molecular Formula | C13H21FN2O6S |
| Molecular Weight | 352.38 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | tert-butyl 3-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)-4-hydroxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)C(N2CC(S(=O)(=O)F)CC2=O)C1 |
| InChI | InChI=1S/C13H21FN2O6S/c1-13(2,3)22-12(19)15-6-9(10(17)7-15)16-5-8(4-11(16)18)23(14,20)21/h8-10,17H,4-7H2,1-3H3 |
| InChIKey | IYCVGCMRNYTABE-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.38 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |