C10H10FNO6S — CID 168713987
methyl 5-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)furan-2-carboxylate (PubChem CID 168713987) has the molecular formula C10H10FNO6S and a molecular weight of 291.26 g/mol. Its IUPAC name is methyl 5-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)furan-2-carboxylate.
| Compound Name | methyl 5-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)furan-2-carboxylate |
|---|---|
| PubChem CID | 168713987 |
| Molecular Formula | C10H10FNO6S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.02 |
| IUPAC Name | methyl 5-(4-fluorosulfonyl-2-oxopyrrolidin-1-yl)furan-2-carboxylate |
| SMILES | COC(=O)c1ccc(N2CC(S(=O)(=O)F)CC2=O)o1 |
| InChI | InChI=1S/C10H10FNO6S/c1-17-10(14)7-2-3-9(18-7)12-5-6(4-8(12)13)19(11,15)16/h2-3,6H,4-5H2,1H3 |
| InChIKey | SKAOVZSUWJIBNW-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |