C10H6ClF2N3OS — CID 168719703
2-chloro-N-[5-(2,3-difluorophenyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 168719703) has the molecular formula C10H6ClF2N3OS and a molecular weight of 289.69 g/mol. Its IUPAC name is 2-chloro-N-[5-(2,3-difluorophenyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-chloro-N-[5-(2,3-difluorophenyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 168719703 |
| Molecular Formula | C10H6ClF2N3OS |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 2-chloro-N-[5-(2,3-difluorophenyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CCl)Nc1nnc(-c2cccc(F)c2F)s1 |
| InChI | InChI=1S/C10H6ClF2N3OS/c11-4-7(17)14-10-16-15-9(18-10)5-2-1-3-6(12)8(5)13/h1-3H,4H2,(H,14,16,17) |
| InChIKey | KQPVOSQRKOJXQT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|