C15H25F2O3P — CID 168720251
(4R)-4-(4-diethoxyphosphoryl-4,4-difluorobut-1-en-2-yl)-1-methylcyclohexene (PubChem CID 168720251) has the molecular formula C15H25F2O3P and a molecular weight of 322.33 g/mol. Its IUPAC name is (4R)-4-(4-diethoxyphosphoryl-4,4-difluorobut-1-en-2-yl)-1-methylcyclohexene.
| Compound Name | (4R)-4-(4-diethoxyphosphoryl-4,4-difluorobut-1-en-2-yl)-1-methylcyclohexene |
|---|---|
| PubChem CID | 168720251 |
| Molecular Formula | C15H25F2O3P |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (4R)-4-(4-diethoxyphosphoryl-4,4-difluorobut-1-en-2-yl)-1-methylcyclohexene |
| SMILES | C=C(CC(F)(F)P(=O)(OCC)OCC)[C@H]1CC=C(C)CC1 |
| InChI | InChI=1S/C15H25F2O3P/c1-5-19-21(18,20-6-2)15(16,17)11-13(4)14-9-7-12(3)8-10-14/h7,14H,4-6,8-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | DWVDWRZQUFGKPU-AWEZNQCLSA-N |
| XLogP | 5.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|