C15H30FO3P — CID 101149178
(6S)-9-diethoxyphosphoryl-9-fluoro-2,6-dimethylnon-2-ene (PubChem CID 101149178) has the molecular formula C15H30FO3P and a molecular weight of 308.37 g/mol. Its IUPAC name is (6S)-9-diethoxyphosphoryl-9-fluoro-2,6-dimethylnon-2-ene.
| Compound Name | (6S)-9-diethoxyphosphoryl-9-fluoro-2,6-dimethylnon-2-ene |
|---|---|
| PubChem CID | 101149178 |
| Molecular Formula | C15H30FO3P |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | (6S)-9-diethoxyphosphoryl-9-fluoro-2,6-dimethylnon-2-ene |
| SMILES | CCOP(=O)(OCC)C(F)CC[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C15H30FO3P/c1-6-18-20(17,19-7-2)15(16)12-11-14(5)10-8-9-13(3)4/h9,14-15H,6-8,10-12H2,1-5H3/t14-,15?/m0/s1 |
| InChIKey | ZGRNHRBEIVWDGG-MLCCFXAWSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|