C15H32O6P2 — CID 134930338
9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnon-2-ene (PubChem CID 134930338) has the molecular formula C15H32O6P2 and a molecular weight of 370.36 g/mol. Its IUPAC name is 9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnon-2-ene.
| Compound Name | 9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnon-2-ene |
|---|---|
| PubChem CID | 134930338 |
| Molecular Formula | C15H32O6P2 |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 9,9-bis(dimethoxyphosphoryl)-2,6-dimethylnon-2-ene |
| SMILES | COP(=O)(OC)C(CCC(C)CCC=C(C)C)P(=O)(OC)OC |
| InChI | InChI=1S/C15H32O6P2/c1-13(2)9-8-10-14(3)11-12-15(22(16,18-4)19-5)23(17,20-6)21-7/h9,14-15H,8,10-12H2,1-7H3 |
| InChIKey | JBHHYAJTGAPCHV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|