C36H28N6O2Pt — CID 168720964
4-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-8-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-ol;platinum (PubChem CID 168720964) has the molecular formula C36H28N6O2Pt and a molecular weight of 771.74 g/mol. Its IUPAC name is 4-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-8-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-ol;platinum.
| Compound Name | 4-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-8-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-ol;platinum |
|---|---|
| PubChem CID | 168720964 |
| Molecular Formula | C36H28N6O2Pt |
| Molecular Weight | 771.74 g/mol |
| Exact Mass | 771.19 |
| IUPAC Name | 4-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-8-phenyl-3,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2(7),3,5,9,11-hexaen-13-ol;platinum |
| SMILES | CC(C)(C)c1cc(Oc2ccc3c(n2)c2c(O)ccnc2n3-c2ccccc2)nc(-n2c3ccccc3c3cccnc32)c1.[Pt] |
| InChI | InChI=1S/C36H28N6O2.Pt/c1-36(2,3)22-20-29(42-26-14-8-7-12-24(26)25-13-9-18-37-34(25)42)39-31(21-22)44-30-16-15-27-33(40-30)32-28(43)17-19-38-35(32)41(27)23-10-5-4-6-11-23;/h4-21H,1-3H3,(H,38,43); |
| InChIKey | BWBFYEZEPGSXGN-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.74 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |