C33H28N4OPtSi — CID 168721010
6-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-9,9-dimethyl-4,5-dihydro-[1]benzosilolo[2,3-b]pyridine-4,5-diide;platinum(2+) (PubChem CID 168721010) has the molecular formula C33H28N4OPtSi and a molecular weight of 719.78 g/mol. Its IUPAC name is 6-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-9,9-dimethyl-4,5-dihydro-[1]benzosilolo[2,3-b]pyridine-4,5-diide;platinum(2+).
| Compound Name | 6-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-9,9-dimethyl-4,5-dihydro-[1]benzosilolo[2,3-b]pyridine-4,5-diide;platinum(2+) |
|---|---|
| PubChem CID | 168721010 |
| Molecular Formula | C33H28N4OPtSi |
| Molecular Weight | 719.78 g/mol |
| Exact Mass | 719.17 |
| IUPAC Name | 6-[(4-tert-butyl-6-pyrido[2,3-b]indol-9-yl-2-pyridinyl)oxy]-9,9-dimethyl-4,5-dihydro-[1]benzosilolo[2,3-b]pyridine-4,5-diide;platinum(2+) |
| SMILES | CC(C)(C)c1cc(Oc2[c-]c3c(cc2)[Si](C)(C)c2ncc[c-]c2-3)nc(-n2c3ccccc3c3cccnc32)c1.[Pt+2] |
| InChI | InChI=1S/C33H28N4OSi.Pt/c1-33(2,3)21-18-29(37-27-13-7-6-10-23(27)24-11-8-16-34-31(24)37)36-30(19-21)38-22-14-15-28-26(20-22)25-12-9-17-35-32(25)39(28,4)5;/h6-11,13-19H,1-5H3;/q-2;+2 |
| InChIKey | CWJKTZJYEFEOJF-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.78 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|