C26H20I3OS+ — CID 168731339
diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium (PubChem CID 168731339) has the molecular formula C26H20I3OS+ and a molecular weight of 761.22 g/mol. Its IUPAC name is diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium.
| Compound Name | diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium |
|---|---|
| PubChem CID | 168731339 |
| Molecular Formula | C26H20I3OS+ |
| Molecular Weight | 761.22 g/mol |
| Exact Mass | 760.84 |
| IUPAC Name | diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)c1c(I)cc(I)cc1I |
| InChI | InChI=1S/C26H20I3OS/c1-18(26-24(28)16-19(27)17-25(26)29)30-20-12-14-23(15-13-20)31(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-18H,1H3/q+1 |
| InChIKey | ZRFZTBJRKMHQGQ-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.22 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|