About diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium
diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium (PubChem CID 168731339) has the molecular formula C26H20I3OS+
and a molecular weight of 761.22 g/mol. Its IUPAC name is diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium.
Molecular Properties
| Compound Name | diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium |
| PubChem CID | 168731339 |
| Molecular Formula | C26H20I3OS+ |
| Molecular Weight | 761.22 g/mol |
| Exact Mass | 760.84 |
| IUPAC Name | diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)c1c(I)cc(I)cc1I |
| InChI | InChI=1S/C26H20I3OS/c1-18(26-24(28)16-19(27)17-25(26)29)30-20-12-14-23(15-13-20)31(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-18H,1H3/q+1 |
| InChIKey | ZRFZTBJRKMHQGQ-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 761.22 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium?
The IUPAC name of diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium (CID 168731339) is diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium.
What is the SMILES notation for diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium?
The canonical SMILES for diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium is CC(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)c1c(I)cc(I)cc1I.
What is the InChIKey of diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium?
The InChIKey is ZRFZTBJRKMHQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20I3OS/c1-18(26-24(28)16-19(27)17-25(26)29)30-20-12-14-23(15-13-20)31(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-18H,1H3/q+1.
What are the key properties of diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium?
diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium has a molecular weight of 761.22 g/mol, XLogP of 8.74, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphenyl-[4-[1-(2,4,6-triiodophenyl)ethoxy]phenyl]sulfanium is sourced from PubChem (CID 168731339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).