C26H21I2O2S+ — CID 165155266
[4-[1-(2-hydroxy-3,5-diiodophenyl)ethoxy]phenyl]-diphenylsulfanium (PubChem CID 165155266) has the molecular formula C26H21I2O2S+ and a molecular weight of 651.33 g/mol. Its IUPAC name is [4-[1-(2-hydroxy-3,5-diiodophenyl)ethoxy]phenyl]-diphenylsulfanium.
| Compound Name | [4-[1-(2-hydroxy-3,5-diiodophenyl)ethoxy]phenyl]-diphenylsulfanium |
|---|---|
| PubChem CID | 165155266 |
| Molecular Formula | C26H21I2O2S+ |
| Molecular Weight | 651.33 g/mol |
| Exact Mass | 650.93 |
| IUPAC Name | [4-[1-(2-hydroxy-3,5-diiodophenyl)ethoxy]phenyl]-diphenylsulfanium |
| SMILES | CC(Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C26H20I2O2S/c1-18(24-16-19(27)17-25(28)26(24)29)30-20-12-14-23(15-13-20)31(21-8-4-2-5-9-21)22-10-6-3-7-11-22/h2-18H,1H3/p+1 |
| InChIKey | DPXBGYCHDYEFJU-UHFFFAOYSA-O |
| XLogP | 7.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.33 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|