C19H13I3O3S — CID 158897664
diphenyl-(2,4,6-triiodophenyl)sulfanium;hydrogen carbonate (PubChem CID 158897664) has the molecular formula C19H13I3O3S and a molecular weight of 702.09 g/mol. Its IUPAC name is diphenyl-(2,4,6-triiodophenyl)sulfanium;hydrogen carbonate.
| Compound Name | diphenyl-(2,4,6-triiodophenyl)sulfanium;hydrogen carbonate |
|---|---|
| PubChem CID | 158897664 |
| Molecular Formula | C19H13I3O3S |
| Molecular Weight | 702.09 g/mol |
| Exact Mass | 701.77 |
| IUPAC Name | diphenyl-(2,4,6-triiodophenyl)sulfanium;hydrogen carbonate |
| SMILES | Ic1cc(I)c([S+](c2ccccc2)c2ccccc2)c(I)c1.O=C([O-])O |
| InChI | InChI=1S/C18H12I3S.CH2O3/c19-13-11-16(20)18(17(21)12-13)22(14-7-3-1-4-8-14)15-9-5-2-6-10-15;2-1(3)4/h1-12H;(H2,2,3,4)/q+1;/p-1 |
| InChIKey | JFAOCVGXZUYDNV-UHFFFAOYSA-M |
| XLogP | 5.48 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.09 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|