C17H34N3O2+ — CID 168735202
trimethyl-[2-oxo-2-[4-(2,2,3,3-tetramethylbutanoyl)piperazin-1-yl]ethyl]azanium (PubChem CID 168735202) has the molecular formula C17H34N3O2+ and a molecular weight of 312.48 g/mol. Its IUPAC name is trimethyl-[2-oxo-2-[4-(2,2,3,3-tetramethylbutanoyl)piperazin-1-yl]ethyl]azanium.
| Compound Name | trimethyl-[2-oxo-2-[4-(2,2,3,3-tetramethylbutanoyl)piperazin-1-yl]ethyl]azanium |
|---|---|
| PubChem CID | 168735202 |
| Molecular Formula | C17H34N3O2+ |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.26 |
| IUPAC Name | trimethyl-[2-oxo-2-[4-(2,2,3,3-tetramethylbutanoyl)piperazin-1-yl]ethyl]azanium |
| SMILES | CC(C)(C)C(C)(C)C(=O)N1CCN(C(=O)C[N+](C)(C)C)CC1 |
| InChI | InChI=1S/C17H34N3O2/c1-16(2,3)17(4,5)15(22)19-11-9-18(10-12-19)14(21)13-20(6,7)8/h9-13H2,1-8H3/q+1 |
| InChIKey | XGODWVNZWCICJQ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|