C10H18F3N2Y- — CID 168742387
(N-propan-2-yl-C-propylcarbonimidoyl)-(1,1,1-trifluoropropan-2-yl)azanide;yttrium (PubChem CID 168742387) has the molecular formula C10H18F3N2Y- and a molecular weight of 312.17 g/mol. Its IUPAC name is (N-propan-2-yl-C-propylcarbonimidoyl)-(1,1,1-trifluoropropan-2-yl)azanide;yttrium.
| Compound Name | (N-propan-2-yl-C-propylcarbonimidoyl)-(1,1,1-trifluoropropan-2-yl)azanide;yttrium |
|---|---|
| PubChem CID | 168742387 |
| Molecular Formula | C10H18F3N2Y- |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | (N-propan-2-yl-C-propylcarbonimidoyl)-(1,1,1-trifluoropropan-2-yl)azanide;yttrium |
| SMILES | CCC/C(=N\C(C)C)[N-]C(C)C(F)(F)F.[Y] |
| InChI | InChI=1S/C10H18F3N2.Y/c1-5-6-9(14-7(2)3)15-8(4)10(11,12)13;/h7-8H,5-6H2,1-4H3;/q-1; |
| InChIKey | SUWGFTDPMMHRKO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 26.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|