About 4-bromo-1,2-dideuteriooxybenzene
4-bromo-1,2-dideuteriooxybenzene (PubChem CID 168744345) has the molecular formula C6H5BrO2
and a molecular weight of 191.02 g/mol. Its IUPAC name is 4-bromo-1,2-dideuteriooxybenzene.
Molecular Properties
| Compound Name | 4-bromo-1,2-dideuteriooxybenzene |
| PubChem CID | 168744345 |
| Molecular Formula | C6H5BrO2 |
| Molecular Weight | 191.02 g/mol |
| Exact Mass | 189.96 |
| IUPAC Name | 4-bromo-1,2-dideuteriooxybenzene |
| SMILES | [2H]Oc1ccc(Br)cc1O[2H] |
| InChI | InChI=1S/C6H5BrO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H/i/hD2 |
| InChIKey | AQVKHRQMAUJBBP-ZSJDYOACSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.02 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-1,2-dideuteriooxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1,2-dideuteriooxybenzene?
The IUPAC name of 4-bromo-1,2-dideuteriooxybenzene (CID 168744345) is 4-bromo-1,2-dideuteriooxybenzene.
What is the SMILES notation for 4-bromo-1,2-dideuteriooxybenzene?
The canonical SMILES for 4-bromo-1,2-dideuteriooxybenzene is [2H]Oc1ccc(Br)cc1O[2H].
What is the InChIKey of 4-bromo-1,2-dideuteriooxybenzene?
The InChIKey is AQVKHRQMAUJBBP-ZSJDYOACSA-N. The full InChI is InChI=1S/C6H5BrO2/c7-4-1-2-5(8)6(9)3-4/h1-3,8-9H/i/hD2.
What are the key properties of 4-bromo-1,2-dideuteriooxybenzene?
4-bromo-1,2-dideuteriooxybenzene has a molecular weight of 191.02 g/mol, XLogP of 1.86, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1,2-dideuteriooxybenzene is sourced from PubChem (CID 168744345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).